C13H12BrNO3S — CID 81308582
2-[(4-bromothiophen-2-yl)methylamino]-4-methoxybenzoic acid (PubChem CID 81308582) has the molecular formula C13H12BrNO3S and a molecular weight of 342.21 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methylamino]-4-methoxybenzoic acid.
| Compound Name | 2-[(4-bromothiophen-2-yl)methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 81308582 |
| Molecular Formula | C13H12BrNO3S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(NCc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C13H12BrNO3S/c1-18-9-2-3-11(13(16)17)12(5-9)15-6-10-4-8(14)7-19-10/h2-5,7,15H,6H2,1H3,(H,16,17) |
| InChIKey | PTDHGPKRKKEKRQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |