C13H12BrF2NO2S — CID 43699802
N-[(4-bromothiophen-2-yl)methyl]-2-(difluoromethoxy)-5-methoxyaniline (PubChem CID 43699802) has the molecular formula C13H12BrF2NO2S and a molecular weight of 364.21 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(difluoromethoxy)-5-methoxyaniline.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(difluoromethoxy)-5-methoxyaniline |
|---|---|
| PubChem CID | 43699802 |
| Molecular Formula | C13H12BrF2NO2S |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(difluoromethoxy)-5-methoxyaniline |
| SMILES | COc1ccc(OC(F)F)c(NCc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C13H12BrF2NO2S/c1-18-9-2-3-12(19-13(15)16)11(5-9)17-6-10-4-8(14)7-20-10/h2-5,7,13,17H,6H2,1H3 |
| InChIKey | AARQMPHAFFSAKR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |