C13H12BrFN2OS — CID 54862670
N-[5-[(4-bromothiophen-2-yl)methylamino]-2-fluorophenyl]acetamide (PubChem CID 54862670) has the molecular formula C13H12BrFN2OS and a molecular weight of 343.22 g/mol. Its IUPAC name is N-[5-[(4-bromothiophen-2-yl)methylamino]-2-fluorophenyl]acetamide.
| Compound Name | N-[5-[(4-bromothiophen-2-yl)methylamino]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 54862670 |
| Molecular Formula | C13H12BrFN2OS |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | N-[5-[(4-bromothiophen-2-yl)methylamino]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NCc2cc(Br)cs2)ccc1F |
| InChI | InChI=1S/C13H12BrFN2OS/c1-8(18)17-13-5-10(2-3-12(13)15)16-6-11-4-9(14)7-19-11/h2-5,7,16H,6H2,1H3,(H,17,18) |
| InChIKey | SLIJUVPOMWYARJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |