About N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide
N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide (PubChem CID 63667393) has the molecular formula C15H13F3N2O
and a molecular weight of 294.27 g/mol. Its IUPAC name is N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide.
Molecular Properties
| Compound Name | N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide |
| PubChem CID | 63667393 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)NC1=C(C=CC(=C1)NCC2=C(C(=CC=C2)F)F)F |
| InChI | InChI=1S/C15H13F3N2O/c1-9(21)20-14-7-11(5-6-12(14)16)19-8-10-3-2-4-13(17)15(10)18/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | GEVRVJIFVAXPJC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 356 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide?
The IUPAC name of N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide (CID 63667393) is N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide.
What is the SMILES notation for N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide?
The canonical SMILES for N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide is CC(=O)NC1=C(C=CC(=C1)NCC2=C(C(=CC=C2)F)F)F.
What is the InChIKey of N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide?
The InChIKey is GEVRVJIFVAXPJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O/c1-9(21)20-14-7-11(5-6-12(14)16)19-8-10-3-2-4-13(17)15(10)18/h2-7,19H,8H2,1H3,(H,20,21).
What are the key properties of N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide?
N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide has a molecular weight of 294.27 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(2,3-difluorophenyl)methylamino]-2-fluorophenyl]acetamide is sourced from PubChem (CID 63667393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).