C15H12F4N2O — CID 75469999
N-[2-fluoro-5-[(2,4,5-trifluorophenyl)methylamino]phenyl]acetamide (PubChem CID 75469999) has the molecular formula C15H12F4N2O and a molecular weight of 312.27 g/mol. Its IUPAC name is N-[2-fluoro-5-[(2,4,5-trifluorophenyl)methylamino]phenyl]acetamide.
| Compound Name | N-[2-fluoro-5-[(2,4,5-trifluorophenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 75469999 |
| Molecular Formula | C15H12F4N2O |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[2-fluoro-5-[(2,4,5-trifluorophenyl)methylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NCc2cc(F)c(F)cc2F)ccc1F |
| InChI | InChI=1S/C15H12F4N2O/c1-8(22)21-15-5-10(2-3-11(15)16)20-7-9-4-13(18)14(19)6-12(9)17/h2-6,20H,7H2,1H3,(H,21,22) |
| InChIKey | GUGSDUFCLRQVOM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|