C29H38FN3O2 — CID 16667140
2-[1-[4-[(2-cyclohexylacetyl)amino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide (PubChem CID 16667140) has the molecular formula C29H38FN3O2 and a molecular weight of 479.64 g/mol. Its IUPAC name is 2-[1-[4-[(2-cyclohexylacetyl)amino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide.
| Compound Name | 2-[1-[4-[(2-cyclohexylacetyl)amino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 16667140 |
| Molecular Formula | C29H38FN3O2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 2-[1-[4-[(2-cyclohexylacetyl)amino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide |
| SMILES | CCNC(=O)C(c1ccccc1)C1CCN(c2ccc(NC(=O)CC3CCCCC3)cc2F)CC1 |
| InChI | InChI=1S/C29H38FN3O2/c1-2-31-29(35)28(22-11-7-4-8-12-22)23-15-17-33(18-16-23)26-14-13-24(20-25(26)30)32-27(34)19-21-9-5-3-6-10-21/h4,7-8,11-14,20-21,23,28H,2-3,5-6,9-10,15-19H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | OGMBOYQZZCOSLF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|