C29H39FN5O3+ — CID 143452929
[[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluoroanilino]-hydroxymethylidene]-(3,5-dimethyl-2,3-dihydro-1,2-oxazol-4-yl)azanium (PubChem CID 143452929) has the molecular formula C29H39FN5O3+ and a molecular weight of 524.66 g/mol. Its IUPAC name is [[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluoroanilino]-hydroxymethylidene]-(3,5-dimethyl-2,3-dihydro-1,2-oxazol-4-yl)azanium.
| Compound Name | [[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluoroanilino]-hydroxymethylidene]-(3,5-dimethyl-2,3-dihydro-1,2-oxazol-4-yl)azanium |
|---|---|
| PubChem CID | 143452929 |
| Molecular Formula | C29H39FN5O3+ |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluoroanilino]-hydroxymethylidene]-(3,5-dimethyl-2,3-dihydro-1,2-oxazol-4-yl)azanium |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)C1CCN(c2ccc(N/C(O)=[NH+]/C3=C(C)ONC3C)cc2F)CC1 |
| InChI | InChI=1S/C29H38FN5O3/c1-5-34(6-2)28(36)26(21-10-8-7-9-11-21)22-14-16-35(17-15-22)25-13-12-23(18-24(25)30)31-29(37)32-27-19(3)33-38-20(27)4/h7-13,18-19,22,26,33H,5-6,14-17H2,1-4H3,(H2,31,32,37)/p+1 |
| InChIKey | RZOCWEBKNMTVDF-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|