C30H43FN4O3 — CID 69322347
N-[4-[4-[1-(diethylamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide (PubChem CID 69322347) has the molecular formula C30H43FN4O3 and a molecular weight of 526.70 g/mol. Its IUPAC name is N-[4-[4-[1-(diethylamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide.
| Compound Name | N-[4-[4-[1-(diethylamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 69322347 |
| Molecular Formula | C30H43FN4O3 |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | N-[4-[4-[1-(diethylamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(Cc3ccc(OC)cc3)C(=O)N(CC)CC)CC2)c(F)c1 |
| InChI | InChI=1S/C30H43FN4O3/c1-6-23(7-2)29(36)32-24-12-15-27(26(31)21-24)34-16-18-35(19-17-34)28(30(37)33(8-3)9-4)20-22-10-13-25(38-5)14-11-22/h10-15,21,23,28H,6-9,16-20H2,1-5H3,(H,32,36) |
| InChIKey | IZXVAUBLSPECQO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|