C30H41N5O3 — CID 58870668
N-[4-[4-[2-(diethylamino)-1-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]-3-isocyanophenyl]-2-ethylbutanamide (PubChem CID 58870668) has the molecular formula C30H41N5O3 and a molecular weight of 519.69 g/mol. Its IUPAC name is N-[4-[4-[2-(diethylamino)-1-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]-3-isocyanophenyl]-2-ethylbutanamide.
| Compound Name | N-[4-[4-[2-(diethylamino)-1-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]-3-isocyanophenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 58870668 |
| Molecular Formula | C30H41N5O3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | N-[4-[4-[2-(diethylamino)-1-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]-3-isocyanophenyl]-2-ethylbutanamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)C(CC)CC)ccc1N1CCN(C(C(=O)N(CC)CC)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C30H41N5O3/c1-7-22(8-2)29(36)32-24-13-16-27(26(21-24)31-5)34-17-19-35(20-18-34)28(30(37)33(9-3)10-4)23-11-14-25(38-6)15-12-23/h11-16,21-22,28H,7-10,17-20H2,1-4,6H3,(H,32,36) |
| InChIKey | DUFBHLVABAWVGD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|