C29H40N4O3 — CID 58870702
N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-methoxyphenyl]cyclopentanecarboxamide (PubChem CID 58870702) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-methoxyphenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-methoxyphenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 58870702 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-methoxyphenyl]cyclopentanecarboxamide |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)C3CCCC3)cc2OC)CC1 |
| InChI | InChI=1S/C29H40N4O3/c1-4-31(5-2)29(35)27(22-11-7-6-8-12-22)33-19-17-32(18-20-33)25-16-15-24(21-26(25)36-3)30-28(34)23-13-9-10-14-23/h6-8,11-12,15-16,21,23,27H,4-5,9-10,13-14,17-20H2,1-3H3,(H,30,34) |
| InChIKey | ODDPRTGRIPMFLV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|