C29H43N4O3+ — CID 143452986
diethyl-[2-[4-[4-(2-ethylbutanoylamino)-2-methoxyphenyl]piperazin-1-yl]-1-hydroxy-2-phenylethylidene]azanium (PubChem CID 143452986) has the molecular formula C29H43N4O3+ and a molecular weight of 495.69 g/mol. Its IUPAC name is diethyl-[2-[4-[4-(2-ethylbutanoylamino)-2-methoxyphenyl]piperazin-1-yl]-1-hydroxy-2-phenylethylidene]azanium.
| Compound Name | diethyl-[2-[4-[4-(2-ethylbutanoylamino)-2-methoxyphenyl]piperazin-1-yl]-1-hydroxy-2-phenylethylidene]azanium |
|---|---|
| PubChem CID | 143452986 |
| Molecular Formula | C29H43N4O3+ |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | diethyl-[2-[4-[4-(2-ethylbutanoylamino)-2-methoxyphenyl]piperazin-1-yl]-1-hydroxy-2-phenylethylidene]azanium |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(C(O)=[N+](CC)CC)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C29H42N4O3/c1-6-22(7-2)28(34)30-24-15-16-25(26(21-24)36-5)32-17-19-33(20-18-32)27(23-13-11-10-12-14-23)29(35)31(8-3)9-4/h10-16,21-22,27H,6-9,17-20H2,1-5H3,(H,30,34)/p+1 |
| InChIKey | UFLAATHHYNJWMT-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 68.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|