C28H28FN3O3 — CID 58870692
methyl 2-[4-[4-(bicyclo[4.2.0]octa-1,3,5-triene-7-carbonylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 58870692) has the molecular formula C28H28FN3O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is methyl 2-[4-[4-(bicyclo[4.2.0]octa-1,3,5-triene-7-carbonylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[4-(bicyclo[4.2.0]octa-1,3,5-triene-7-carbonylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 58870692 |
| Molecular Formula | C28H28FN3O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | methyl 2-[4-[4-(bicyclo[4.2.0]octa-1,3,5-triene-7-carbonylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)C3Cc4ccccc43)cc2F)CC1 |
| InChI | InChI=1S/C28H28FN3O3/c1-35-28(34)26(19-7-3-2-4-8-19)32-15-13-31(14-16-32)25-12-11-21(18-24(25)29)30-27(33)23-17-20-9-5-6-10-22(20)23/h2-12,18,23,26H,13-17H2,1H3,(H,30,33) |
| InChIKey | YJYMIFIIRFDSBL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|