C28H30FN3O2 — CID 67678449
(3S)-N-[4-(4-benzhydrylpiperazin-1-yl)-3-fluorophenyl]oxolane-3-carboxamide (PubChem CID 67678449) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is (3S)-N-[4-(4-benzhydrylpiperazin-1-yl)-3-fluorophenyl]oxolane-3-carboxamide.
| Compound Name | (3S)-N-[4-(4-benzhydrylpiperazin-1-yl)-3-fluorophenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 67678449 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (3S)-N-[4-(4-benzhydrylpiperazin-1-yl)-3-fluorophenyl]oxolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)c(F)c1)[C@H]1CCOC1 |
| InChI | InChI=1S/C28H30FN3O2/c29-25-19-24(30-28(33)23-13-18-34-20-23)11-12-26(25)31-14-16-32(17-15-31)27(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-12,19,23,27H,13-18,20H2,(H,30,33)/t23-/m0/s1 |
| InChIKey | STSKJQPZEBYZLR-QHCPKHFHSA-N |
| XLogP | 4.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|