C16H20N4O2 — CID 57336447
N-(3-cyano-4-piperazin-1-ylphenyl)oxolane-3-carboxamide (PubChem CID 57336447) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(3-cyano-4-piperazin-1-ylphenyl)oxolane-3-carboxamide.
| Compound Name | N-(3-cyano-4-piperazin-1-ylphenyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 57336447 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(3-cyano-4-piperazin-1-ylphenyl)oxolane-3-carboxamide |
| SMILES | N#Cc1cc(NC(=O)C2CCOC2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C16H20N4O2/c17-10-13-9-14(19-16(21)12-3-8-22-11-12)1-2-15(13)20-6-4-18-5-7-20/h1-2,9,12,18H,3-8,11H2,(H,19,21) |
| InChIKey | XJWMMHQPJJFMDX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|