C30H31F3N2O3 — CID 90316665
N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]oxolane-3-carboxamide (PubChem CID 90316665) has the molecular formula C30H31F3N2O3 and a molecular weight of 524.58 g/mol. Its IUPAC name is N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]oxolane-3-carboxamide.
| Compound Name | N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 90316665 |
| Molecular Formula | C30H31F3N2O3 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]oxolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c(C(F)(F)F)c1)C1CCOC1 |
| InChI | InChI=1S/C30H31F3N2O3/c31-30(32,33)26-19-25(34-28(36)21-15-18-38-20-21)11-12-27(26)35-16-13-24(14-17-35)29(37,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-12,19,21,24,37H,13-18,20H2,(H,34,36) |
| InChIKey | LYLBCVCOPVXRBP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|