C27H27F3N2O2S — CID 70696289
4-[hydroxy(diphenyl)methyl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide (PubChem CID 70696289) has the molecular formula C27H27F3N2O2S and a molecular weight of 500.59 g/mol. Its IUPAC name is 4-[hydroxy(diphenyl)methyl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide.
| Compound Name | 4-[hydroxy(diphenyl)methyl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 70696289 |
| Molecular Formula | C27H27F3N2O2S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 4-[hydroxy(diphenyl)methyl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H27F3N2O2S/c1-34-24-13-12-22(18-23(24)27(28,29)30)31-25(35)32-16-14-21(15-17-32)26(33,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-13,18,21,33H,14-17H2,1H3,(H,31,35) |
| InChIKey | GGZWDGFYXSZWIT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|