C28H28N4O2S — CID 90316762
4-[hydroxy(diphenyl)methyl]-N-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]piperidine-1-carbothioamide (PubChem CID 90316762) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is 4-[hydroxy(diphenyl)methyl]-N-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]piperidine-1-carbothioamide.
| Compound Name | 4-[hydroxy(diphenyl)methyl]-N-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 90316762 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 4-[hydroxy(diphenyl)methyl]-N-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]piperidine-1-carbothioamide |
| SMILES | Cc1noc(-c2ccc(NC(=S)N3CCC(C(O)(c4ccccc4)c4ccccc4)CC3)cc2)n1 |
| InChI | InChI=1S/C28H28N4O2S/c1-20-29-26(34-31-20)21-12-14-25(15-13-21)30-27(35)32-18-16-24(17-19-32)28(33,22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-15,24,33H,16-19H2,1H3,(H,30,35) |
| InChIKey | MYQISURCRJZQLN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|