C25H24Cl2N2OS — CID 17372749
N-(2,4-dichlorophenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide (PubChem CID 17372749) has the molecular formula C25H24Cl2N2OS and a molecular weight of 471.45 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 17372749 |
| Molecular Formula | C25H24Cl2N2OS |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
| SMILES | OC(c1ccccc1)(c1ccccc1)C1CCN(C(=S)Nc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C25H24Cl2N2OS/c26-21-11-12-23(22(27)17-21)28-24(31)29-15-13-20(14-16-29)25(30,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,17,20,30H,13-16H2,(H,28,31) |
| InChIKey | JSXJQQMGYBHTLW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|