C19H19Cl3N2S — CID 134103063
4-benzyl-N-(2,4,5-trichlorophenyl)piperidine-1-carbothioamide (PubChem CID 134103063) has the molecular formula C19H19Cl3N2S and a molecular weight of 413.80 g/mol. Its IUPAC name is 4-benzyl-N-(2,4,5-trichlorophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-benzyl-N-(2,4,5-trichlorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 134103063 |
| Molecular Formula | C19H19Cl3N2S |
| Molecular Weight | 413.80 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 4-benzyl-N-(2,4,5-trichlorophenyl)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1cc(Cl)c(Cl)cc1Cl)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H19Cl3N2S/c20-15-11-17(22)18(12-16(15)21)23-19(25)24-8-6-14(7-9-24)10-13-4-2-1-3-5-13/h1-5,11-12,14H,6-10H2,(H,23,25) |
| InChIKey | OKQOWGYLOGFWOE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.80 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|