C28H32N2OS — CID 70681544
4-[hydroxy(diphenyl)methyl]-N-(4-propylphenyl)piperidine-1-carbothioamide (PubChem CID 70681544) has the molecular formula C28H32N2OS and a molecular weight of 444.64 g/mol. Its IUPAC name is 4-[hydroxy(diphenyl)methyl]-N-(4-propylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[hydroxy(diphenyl)methyl]-N-(4-propylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 70681544 |
| Molecular Formula | C28H32N2OS |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[hydroxy(diphenyl)methyl]-N-(4-propylphenyl)piperidine-1-carbothioamide |
| SMILES | CCCc1ccc(NC(=S)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H32N2OS/c1-2-9-22-14-16-26(17-15-22)29-27(32)30-20-18-25(19-21-30)28(31,23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-8,10-17,25,31H,2,9,18-21H2,1H3,(H,29,32) |
| InChIKey | VEALQJCBSZPZPD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|