C29H34N2OS — CID 123480278
N-(4-tert-butylphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide (PubChem CID 123480278) has the molecular formula C29H34N2OS and a molecular weight of 458.67 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | N-(4-tert-butylphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 123480278 |
| Molecular Formula | C29H34N2OS |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
| SMILES | CC(C)(C)c1ccc(NC(=S)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H34N2OS/c1-28(2,3)22-14-16-26(17-15-22)30-27(33)31-20-18-25(19-21-31)29(32,23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-17,25,32H,18-21H2,1-3H3,(H,30,33) |
| InChIKey | XVXJCAPKHUKWAN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|