C18H19ClN2S — CID 5066125
N-(5-chloro-2-methylphenyl)-3-phenylpyrrolidine-1-carbothioamide (PubChem CID 5066125) has the molecular formula C18H19ClN2S and a molecular weight of 330.88 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-phenylpyrrolidine-1-carbothioamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-phenylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 5066125 |
| Molecular Formula | C18H19ClN2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-phenylpyrrolidine-1-carbothioamide |
| SMILES | Cc1ccc(Cl)cc1NC(=S)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H19ClN2S/c1-13-7-8-16(19)11-17(13)20-18(22)21-10-9-15(12-21)14-5-3-2-4-6-14/h2-8,11,15H,9-10,12H2,1H3,(H,20,22) |
| InChIKey | IVKKTHHOCWGGHX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|