C12H16N2S — CID 134367750
(3S)-N-methyl-3-phenylpyrrolidine-1-carbothioamide (PubChem CID 134367750) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is (3S)-N-methyl-3-phenylpyrrolidine-1-carbothioamide.
| Compound Name | (3S)-N-methyl-3-phenylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134367750 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (3S)-N-methyl-3-phenylpyrrolidine-1-carbothioamide |
| SMILES | CNC(=S)N1CC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C12H16N2S/c1-13-12(15)14-8-7-11(9-14)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,13,15)/t11-/m1/s1 |
| InChIKey | IGARWQJWPJVQFW-LLVKDONJSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|