C19H22N2S — CID 5192797
N-(2,6-dimethylphenyl)-3-phenylpyrrolidine-1-carbothioamide (PubChem CID 5192797) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-phenylpyrrolidine-1-carbothioamide.
| Compound Name | N-(2,6-dimethylphenyl)-3-phenylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 5192797 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-phenylpyrrolidine-1-carbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H22N2S/c1-14-7-6-8-15(2)18(14)20-19(22)21-12-11-17(13-21)16-9-4-3-5-10-16/h3-10,17H,11-13H2,1-2H3,(H,20,22) |
| InChIKey | DQXFXINBEJSCIO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|