C42H60N6S3 — CID 142310416
N-butyl-3-phenylpyrrolidine-1-carbothioamide;N-ethyl-3-phenylpyrrolidine-1-carbothioamide;3-phenyl-N-propylpyrrolidine-1-carbothioamide (PubChem CID 142310416) has the molecular formula C42H60N6S3 and a molecular weight of 745.19 g/mol. Its IUPAC name is N-butyl-3-phenylpyrrolidine-1-carbothioamide;N-ethyl-3-phenylpyrrolidine-1-carbothioamide;3-phenyl-N-propylpyrrolidine-1-carbothioamide.
| Compound Name | N-butyl-3-phenylpyrrolidine-1-carbothioamide;N-ethyl-3-phenylpyrrolidine-1-carbothioamide;3-phenyl-N-propylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 142310416 |
| Molecular Formula | C42H60N6S3 |
| Molecular Weight | 745.19 g/mol |
| Exact Mass | 744.40 |
| IUPAC Name | N-butyl-3-phenylpyrrolidine-1-carbothioamide;N-ethyl-3-phenylpyrrolidine-1-carbothioamide;3-phenyl-N-propylpyrrolidine-1-carbothioamide |
| SMILES | CCCCNC(=S)N1CCC(c2ccccc2)C1.CCCNC(=S)N1CCC(c2ccccc2)C1.CCNC(=S)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2S.C14H20N2S.C13H18N2S/c1-2-3-10-16-15(18)17-11-9-14(12-17)13-7-5-4-6-8-13;1-2-9-15-14(17)16-10-8-13(11-16)12-6-4-3-5-7-12;1-2-14-13(16)15-9-8-12(10-15)11-6-4-3-5-7-11/h4-8,14H,2-3,9-12H2,1H3,(H,16,18);3-7,13H,2,8-11H2,1H3,(H,15,17);3-7,12H,2,8-10H2,1H3,(H,14,16) |
| InChIKey | MJHFLNLWHQNZRL-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.19 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|