C9H18N2S — CID 115601990
3-methyl-N-propylpyrrolidine-1-carbothioamide (PubChem CID 115601990) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 3-methyl-N-propylpyrrolidine-1-carbothioamide.
| Compound Name | 3-methyl-N-propylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 115601990 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-methyl-N-propylpyrrolidine-1-carbothioamide |
| SMILES | CCCNC(=S)N1CCC(C)C1 |
| InChI | InChI=1S/C9H18N2S/c1-3-5-10-9(12)11-6-4-8(2)7-11/h8H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | MQQPWSMFPMHHIH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|