C15H22N2S — CID 4144359
N-(2,6-dimethylphenyl)azepane-1-carbothioamide (PubChem CID 4144359) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)azepane-1-carbothioamide.
| Compound Name | N-(2,6-dimethylphenyl)azepane-1-carbothioamide |
|---|---|
| PubChem CID | 4144359 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)azepane-1-carbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)N1CCCCCC1 |
| InChI | InChI=1S/C15H22N2S/c1-12-8-7-9-13(2)14(12)16-15(18)17-10-5-3-4-6-11-17/h7-9H,3-6,10-11H2,1-2H3,(H,16,18) |
| InChIKey | RVVOXVPZROWMFT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|