C18H25NS — CID 158434350
2-cyclohexyl-1-(3-phenylpyrrolidin-1-yl)ethanethione (PubChem CID 158434350) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3-phenylpyrrolidin-1-yl)ethanethione.
| Compound Name | 2-cyclohexyl-1-(3-phenylpyrrolidin-1-yl)ethanethione |
|---|---|
| PubChem CID | 158434350 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-cyclohexyl-1-(3-phenylpyrrolidin-1-yl)ethanethione |
| SMILES | S=C(CC1CCCCC1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H25NS/c20-18(13-15-7-3-1-4-8-15)19-12-11-17(14-19)16-9-5-2-6-10-16/h2,5-6,9-10,15,17H,1,3-4,7-8,11-14H2 |
| InChIKey | SYTGHSJJRYLTCL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|