C16H23NO — CID 142021655
2-cyclobutyl-1-[(3S)-3-phenylpyrrolidin-1-yl]ethanol (PubChem CID 142021655) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-cyclobutyl-1-[(3S)-3-phenylpyrrolidin-1-yl]ethanol.
| Compound Name | 2-cyclobutyl-1-[(3S)-3-phenylpyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 142021655 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-cyclobutyl-1-[(3S)-3-phenylpyrrolidin-1-yl]ethanol |
| SMILES | OC(CC1CCC1)N1CC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H23NO/c18-16(11-13-5-4-6-13)17-10-9-15(12-17)14-7-2-1-3-8-14/h1-3,7-8,13,15-16,18H,4-6,9-12H2/t15-,16?/m1/s1 |
| InChIKey | KRKQBNMVGHCMBK-AAFJCEBUSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |