C10H11N3O — CID 82468711
N-methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 82468711) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | N-methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 82468711 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | CNc1ccc(-c2nc(C)no2)cc1 |
| InChI | InChI=1S/C10H11N3O/c1-7-12-10(14-13-7)8-3-5-9(11-2)6-4-8/h3-6,11H,1-2H3 |
| InChIKey | BGLIYDIKFNVQPI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |