C15H12IN3O — CID 44560734
4-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]-N-methylaniline (PubChem CID 44560734) has the molecular formula C15H12IN3O and a molecular weight of 377.19 g/mol. Its IUPAC name is 4-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]-N-methylaniline.
| Compound Name | 4-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]-N-methylaniline |
|---|---|
| PubChem CID | 44560734 |
| Molecular Formula | C15H12IN3O |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 4-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]-N-methylaniline |
| SMILES | CNc1ccc(-c2nc(-c3ccc(I)cc3)no2)cc1 |
| InChI | InChI=1S/C15H12IN3O/c1-17-13-8-4-11(5-9-13)15-18-14(19-20-15)10-2-6-12(16)7-3-10/h2-9,17H,1H3 |
| InChIKey | AGCUTZDIJRKLLZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|