C36H36N4O3 — CID 23379886
N-[4-[4-[3-[4-[4-(methylamino)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]phenyl]-8-oxononanamide (PubChem CID 23379886) has the molecular formula C36H36N4O3 and a molecular weight of 572.71 g/mol. Its IUPAC name is N-[4-[4-[3-[4-[4-(methylamino)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]phenyl]-8-oxononanamide.
| Compound Name | N-[4-[4-[3-[4-[4-(methylamino)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]phenyl]-8-oxononanamide |
|---|---|
| PubChem CID | 23379886 |
| Molecular Formula | C36H36N4O3 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | N-[4-[4-[3-[4-[4-(methylamino)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]phenyl]-8-oxononanamide |
| SMILES | CNc1ccc(-c2ccc(-c3noc(-c4ccc(-c5ccc(NC(=O)CCCCCCC(C)=O)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C36H36N4O3/c1-25(41)7-5-3-4-6-8-34(42)38-33-23-19-29(20-24-33)27-11-15-31(16-12-27)36-39-35(40-43-36)30-13-9-26(10-14-30)28-17-21-32(37-2)22-18-28/h9-24,37H,3-8H2,1-2H3,(H,38,42) |
| InChIKey | GISDCMQWMVJMPP-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|