C14H8I2N2O — CID 21231936
3,5-bis(4-iodophenyl)-1,2,4-oxadiazole (PubChem CID 21231936) has the molecular formula C14H8I2N2O and a molecular weight of 474.04 g/mol. Its IUPAC name is 3,5-bis(4-iodophenyl)-1,2,4-oxadiazole.
| Compound Name | 3,5-bis(4-iodophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 21231936 |
| Molecular Formula | C14H8I2N2O |
| Molecular Weight | 474.04 g/mol |
| Exact Mass | 473.87 |
| IUPAC Name | 3,5-bis(4-iodophenyl)-1,2,4-oxadiazole |
| SMILES | Ic1ccc(-c2noc(-c3ccc(I)cc3)n2)cc1 |
| InChI | InChI=1S/C14H8I2N2O/c15-11-5-1-9(2-6-11)13-17-14(19-18-13)10-3-7-12(16)8-4-10/h1-8H |
| InChIKey | PHSSEZYYKHXATN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.04 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|