C9H6ClIN2O — CID 28978814
3-(chloromethyl)-5-(4-iodophenyl)-1,2,4-oxadiazole (PubChem CID 28978814) has the molecular formula C9H6ClIN2O and a molecular weight of 320.52 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(4-iodophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(chloromethyl)-5-(4-iodophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 28978814 |
| Molecular Formula | C9H6ClIN2O |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 3-(chloromethyl)-5-(4-iodophenyl)-1,2,4-oxadiazole |
| SMILES | ClCc1noc(-c2ccc(I)cc2)n1 |
| InChI | InChI=1S/C9H6ClIN2O/c10-5-8-12-9(14-13-8)6-1-3-7(11)4-2-6/h1-4H,5H2 |
| InChIKey | UECHGIKGGWUOCT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|