C10H5ClFN3O — CID 67070618
3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-5-fluorobenzonitrile (PubChem CID 67070618) has the molecular formula C10H5ClFN3O and a molecular weight of 237.62 g/mol. Its IUPAC name is 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 67070618 |
| Molecular Formula | C10H5ClFN3O |
| Molecular Weight | 237.62 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(-c2nc(CCl)no2)c1 |
| InChI | InChI=1S/C10H5ClFN3O/c11-4-9-14-10(16-15-9)7-1-6(5-13)2-8(12)3-7/h1-3H,4H2 |
| InChIKey | AKLQXNCBMFDPOH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|