C11H9N3O2 — CID 106526858
4-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]benzonitrile (PubChem CID 106526858) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 4-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]benzonitrile.
| Compound Name | 4-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 106526858 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 4-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(CCO)no2)cc1 |
| InChI | InChI=1S/C11H9N3O2/c12-7-8-1-3-9(4-2-8)11-13-10(5-6-15)14-16-11/h1-4,15H,5-6H2 |
| InChIKey | GDBXQWATRUACAE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |