C8H7BrN2O2S — CID 115078694
2-[5-(5-bromothiophen-2-yl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 115078694) has the molecular formula C8H7BrN2O2S and a molecular weight of 275.13 g/mol. Its IUPAC name is 2-[5-(5-bromothiophen-2-yl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-[5-(5-bromothiophen-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 115078694 |
| Molecular Formula | C8H7BrN2O2S |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | 2-[5-(5-bromothiophen-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | OCCc1noc(-c2ccc(Br)s2)n1 |
| InChI | InChI=1S/C8H7BrN2O2S/c9-6-2-1-5(14-6)8-10-7(3-4-12)11-13-8/h1-2,12H,3-4H2 |
| InChIKey | ITTWOVTXZQCLQP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |