C11H11N3OS — CID 103734562
5-(3-butyl-1,2,4-oxadiazol-5-yl)thiophene-2-carbonitrile (PubChem CID 103734562) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 5-(3-butyl-1,2,4-oxadiazol-5-yl)thiophene-2-carbonitrile.
| Compound Name | 5-(3-butyl-1,2,4-oxadiazol-5-yl)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103734562 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-(3-butyl-1,2,4-oxadiazol-5-yl)thiophene-2-carbonitrile |
| SMILES | CCCCc1noc(-c2ccc(C#N)s2)n1 |
| InChI | InChI=1S/C11H11N3OS/c1-2-3-4-10-13-11(15-14-10)9-6-5-8(7-12)16-9/h5-6H,2-4H2,1H3 |
| InChIKey | MAXIMDFAEPNYCM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |