C11H12N2O3 — CID 136712503
2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]-5-methylphenol (PubChem CID 136712503) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]-5-methylphenol.
| Compound Name | 2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]-5-methylphenol |
|---|---|
| PubChem CID | 136712503 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-[3-(2-hydroxyethyl)-1,2,4-oxadiazol-5-yl]-5-methylphenol |
| SMILES | Cc1ccc(-c2nc(CCO)no2)c(O)c1 |
| InChI | InChI=1S/C11H12N2O3/c1-7-2-3-8(9(15)6-7)11-12-10(4-5-14)13-16-11/h2-3,6,14-15H,4-5H2,1H3 |
| InChIKey | JFJIZJWZPBJOII-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |