About 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol
2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 115079288) has the molecular formula C11H9F3N2O2
and a molecular weight of 258.20 g/mol. Its IUPAC name is 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol |
| PubChem CID | 115079288 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | OCCc1noc(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C11H9F3N2O2/c12-11(13,14)8-4-2-1-3-7(8)10-15-9(5-6-17)16-18-10/h1-4,17H,5-6H2 |
| InChIKey | JKXSQLGOUGEFQH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol?
The IUPAC name of 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol (CID 115079288) is 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol.
What is the SMILES notation for 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol?
The canonical SMILES for 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol is OCCc1noc(-c2ccccc2C(F)(F)F)n1.
What is the InChIKey of 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol?
The InChIKey is JKXSQLGOUGEFQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2O2/c12-11(13,14)8-4-2-1-3-7(8)10-15-9(5-6-17)16-18-10/h1-4,17H,5-6H2.
What are the key properties of 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol?
2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol has a molecular weight of 258.20 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]ethanol is sourced from PubChem (CID 115079288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).