C9H4BrF3N2O — CID 112571512
3-bromo-5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 112571512) has the molecular formula C9H4BrF3N2O and a molecular weight of 293.04 g/mol. Its IUPAC name is 3-bromo-5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-bromo-5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112571512 |
| Molecular Formula | C9H4BrF3N2O |
| Molecular Weight | 293.04 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | 3-bromo-5-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1ccccc1-c1nc(Br)no1 |
| InChI | InChI=1S/C9H4BrF3N2O/c10-8-14-7(16-15-8)5-3-1-2-4-6(5)9(11,12)13/h1-4H |
| InChIKey | XXOPPMSYIDNDPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.04 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |