C9H10N4O2 — CID 104827143
2-[5-(3-amino-4-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 104827143) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 2-[5-(3-amino-4-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-[5-(3-amino-4-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 104827143 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-[5-(3-amino-4-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | Nc1cnccc1-c1nc(CCO)no1 |
| InChI | InChI=1S/C9H10N4O2/c10-7-5-11-3-1-6(7)9-12-8(2-4-14)13-15-9/h1,3,5,14H,2,4,10H2 |
| InChIKey | QDVFNUFJLGCIGR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |