C9H7ClN2O2 — CID 870621
2-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 870621) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 870621 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 2-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(CCl)no1 |
| InChI | InChI=1S/C9H7ClN2O2/c10-5-8-11-9(14-12-8)6-3-1-2-4-7(6)13/h1-4,13H,5H2 |
| InChIKey | ZGVJDSCNZFSKOG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|