C12H15N3O2 — CID 137002850
2-[3-[3-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 137002850) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[3-[3-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-[3-[3-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 137002850 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-[3-[3-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CNCCCc1noc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C12H15N3O2/c1-13-8-4-7-11-14-12(17-15-11)9-5-2-3-6-10(9)16/h2-3,5-6,13,16H,4,7-8H2,1H3 |
| InChIKey | ADLHZBHDAQSLHF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|