C13H17N3O — CID 115079264
N-methyl-3-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]propan-1-amine (PubChem CID 115079264) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is N-methyl-3-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 115079264 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-methyl-3-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]propan-1-amine |
| SMILES | CNCCCc1noc(-c2cccc(C)c2)n1 |
| InChI | InChI=1S/C13H17N3O/c1-10-5-3-6-11(9-10)13-15-12(16-17-13)7-4-8-14-2/h3,5-6,9,14H,4,7-8H2,1-2H3 |
| InChIKey | QZUAUFYYCMUMCA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|