C10H11N3O — CID 56924173
N-methyl-5-(3-methylphenyl)-1,2,4-oxadiazol-3-amine (PubChem CID 56924173) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-methyl-5-(3-methylphenyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | N-methyl-5-(3-methylphenyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 56924173 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-methyl-5-(3-methylphenyl)-1,2,4-oxadiazol-3-amine |
| SMILES | CNc1noc(-c2cccc(C)c2)n1 |
| InChI | InChI=1S/C10H11N3O/c1-7-4-3-5-8(6-7)9-12-10(11-2)13-14-9/h3-6H,1-2H3,(H,11,13) |
| InChIKey | VQZHCXIVVXFNMZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |