C16H22N2O — CID 59395695
3-(4,4-dimethylpentyl)-5-(3-methylphenyl)-1,2,4-oxadiazole (PubChem CID 59395695) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-(4,4-dimethylpentyl)-5-(3-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4,4-dimethylpentyl)-5-(3-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 59395695 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-(4,4-dimethylpentyl)-5-(3-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cccc(-c2nc(CCCC(C)(C)C)no2)c1 |
| InChI | InChI=1S/C16H22N2O/c1-12-7-5-8-13(11-12)15-17-14(18-19-15)9-6-10-16(2,3)4/h5,7-8,11H,6,9-10H2,1-4H3 |
| InChIKey | WSDZYQBLGHXBJU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |