C14H19N3O — CID 113442813
N-methyl-4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 113442813) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-methyl-4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | N-methyl-4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 113442813 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-methyl-4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CNc1ccc(-c2nc(CCC(C)C)no2)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-10(2)4-9-13-16-14(18-17-13)11-5-7-12(15-3)8-6-11/h5-8,10,15H,4,9H2,1-3H3 |
| InChIKey | RMQAEXXGGBGZIR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |