C26H27N5O3 — CID 77334644
N-[3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]oxolane-3-carboxamide (PubChem CID 77334644) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]oxolane-3-carboxamide.
| Compound Name | N-[3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 77334644 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]oxolane-3-carboxamide |
| SMILES | N#Cc1cc(NC(=O)C2CCOC2)ccc1N1CCN(C(c2ccccc2)c2ncco2)CC1 |
| InChI | InChI=1S/C26H27N5O3/c27-17-21-16-22(29-25(32)20-8-14-33-18-20)6-7-23(21)30-10-12-31(13-11-30)24(26-28-9-15-34-26)19-4-2-1-3-5-19/h1-7,9,15-16,20,24H,8,10-14,18H2,(H,29,32) |
| InChIKey | YVYBRQXIVYWAFO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|