C22H21N5O2 — CID 68993605
3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]benzamide (PubChem CID 68993605) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]benzamide.
| Compound Name | 3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 68993605 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-cyano-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]benzamide |
| SMILES | N#Cc1cc(C(N)=O)ccc1N1CCN(C(c2ccccc2)c2ncco2)CC1 |
| InChI | InChI=1S/C22H21N5O2/c23-15-18-14-17(21(24)28)6-7-19(18)26-9-11-27(12-10-26)20(22-25-8-13-29-22)16-4-2-1-3-5-16/h1-8,13-14,20H,9-12H2,(H2,24,28) |
| InChIKey | UFVXOIBZNJTZCD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |